Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, Formula: C14H12O4, 131-53-3, Name is Dioxybenzone, SMILES is O=C(C1=CC=C(OC)C=C1O)C2=CC=CC=C2O, belongs to chiral-nitrogen-ligands compound. In a document, author is Hoang-Van Tran, introduce the new discover.
Synthesis of heterocyclic enamine-zinc complexes as precursors of stereocontrolled substitution of nitrogen alpha-position
In the presence of ZnCl2, chiral protected amino-ketones and amino-aldehydes gave zinc enamino-complexes. Both enamine and iminium structures of these complexes were observed in H-1 and C-13 NMR spectra depending on the solvent. Introduction of either an allyl or a hydrogen substituent was performed using allylmagnesium chloride or NaBH4 in excess leading to various heterocycles. With the aminoketones diastereoselectivity (de = 50) was observed respectively. Homoconiine and coniine precursors were prepared by this strategy. (C) 2020 Elsevier Ltd. All rights reserved.
A reaction mechanism is the microscopic path by which reactants are transformed into products. Each step is an elementary reaction. In my other articles, you can also check out more blogs about 131-53-3. Formula: C14H12O4.
Reference:
Chiral nitrogen ligands in late transition metal-catalysed asymmetric synthesis¡ªI. Addressing the problem of ligand lability in rhodium-catalysed hydrosilations,
,Nitrogen-Containing Ligands for Asymmetric Homogeneous and Heterogeneous Catalysis