Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, Safety of 3-(Dodec-2-en-1-yl)dihydrofuran-2,5-dione, 26544-38-7, Name is 3-(Dodec-2-en-1-yl)dihydrofuran-2,5-dione, SMILES is O=C(O1)C(C/C=C/CCCCCCCCC)CC1=O, belongs to chiral-nitrogen-ligands compound. In a document, author is Lin, Yan, introduce the new discover.
Desymmetrization-Oriented Enantioselective Synthesis of Silicon-Stereogenic Silanes by Palladium-Catalyzed C-H Olefinations
A palladium-catalyzed chelation-assisted enantioselective C-H olefination of symmetrically diaryl-substituted tetraorganosilicon derivatives was developed, enabling the generation of nitrogen-containing silicon-stereogenic tetraorganosilicon compounds with modest to good yields and good to excellent enantioselectivities (up to 95.5:4.5 e.r.). The Thorpe-Ingold effect exerted by the substituents on silicon was observed to have a profound influence on formation of olefinated products which were further converted into other relevant chiral organosilanes without the loss of enantiomeric purity, thus demonstrating the synthetic utility of the developed enantioselective olefination.
The proportionality constant is the rate constant for the particular unimolecular reaction. the reaction rate is directly proportional to the concentration of the reactant. I hope my blog about 26544-38-7 is helpful to your research. Safety of 3-(Dodec-2-en-1-yl)dihydrofuran-2,5-dione.
Reference:
Chiral nitrogen ligands in late transition metal-catalysed asymmetric synthesis¡ªI. Addressing the problem of ligand lability in rhodium-catalysed hydrosilations,
,Nitrogen-Containing Ligands for Asymmetric Homogeneous and Heterogeneous Catalysis